| Identification | |
| Name: | methyl 3,3-dimethylacrylate |
| Synonyms: | 3,3-Dimethylacrylic acid methyl ester~3-Methyl-2-butenoic acid methyl ester~Methyl 3-methyl-2-butenoate; 3-Methoxy-2,4,5-trifluorobenzoyl chloride; Methyl 3-methyl-2-butenoate; 3,3-Dimethyl Acrylate |
| CAS: | 924-50-5 |
| EINECS: | 213-107-4 |
| Molecular Formula: | C6H10O2 |
| Molecular Weight: | 114.14 |
| InChI: | InChI=1/C6H10O2/c1-5(2)4-6(7)8-3/h4H,1-3H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 1992 |
| Flash Point: | 99? |
| Density: | 0.873 |
| Refractive index: | 1.4364 |
| Solubility: | 11 g/L (25 C) |
| Appearance: | colorless liquid |
| Specification: |
Methyl 3-methyl-2-butenoate , with CAS number of 924-50-5, can be called Senecioic acid, methyl ester (6CI) ; 3-Methyl-2-butenoic acid methyl ester ; 3-Methylcrotonic acid methyl ester ; Methyl 3,3-dimethacrylate ; Methyl 3,3-dimethylacrylate ; Methyl b,b-dimethylacrylate . |
| Packinggroup: | III |
| Flash Point: | 99? |
| Storage Temperature: | Keep tightly closed. Keep away from heat, sparks, and open flame. Store in a cool dry place. |
| Safety Data | |
| Hazard Symbols |
Xi: Irritant
|
 |
|
