| Identification | |
| Name: | Ethanol, 2-bromo-,1-acetate |
| Synonyms: | Ethanol,2-bromo-, acetate (6CI,7CI,8CI,9CI);1-Acetoxy-2-bromoethane;1-Bromo-2-acetoxyethane;2-Acetoxyethyl bromide;Acetic acid 2-bromoethyl ester;NSC 7079; |
| CAS: | 927-68-4 |
| EINECS: | 213-159-8 |
| Molecular Formula: | C4H7BrO2 |
| Molecular Weight: | 167 |
| InChI: | InChI=1/C4H7BrO2/c1-4(6)7-3-2-5/h2-3H2,1H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | 1760 |
| Refractive index: | n20/D 1.455(lit.) |
| Solubility: | Slightly soluble |
| Appearance: | colorless transparent liquid |
| Specification: |
2-Bromoethyl acetate (927-68-4) also can be called ethanol, 2-bromo-, acetate ; 2-Bromoethyl acetate (927-68-4) also can be called ethanol, 2-bromo-, acetate . |
| Report: |
Reported in EPA TSCA Inventory. |
| Packinggroup: | III |
| Storage Temperature: | Keep tightly closed. Keep away from heat and open flame. Store in a cool dry place. |
| Safety Data | |
| Hazard Symbols |
Xi: Irritant
|
 |
|
