| Identification | |
| Name: | Isoxazolo[5,4-b]pyridin-3-amine |
| Synonyms: | ISOXAZOLO[5,4-B]PYRIDIN-3-AMINE;ISOXAZOLO[5,4-B]PYRIDIN-3-YLAMINE |
| CAS: | 92914-74-4 |
| Molecular Formula: | C6H5 N3 O |
| Molecular Weight: | 135.12 |
| InChI: | InChI=1/C6H5N3O/c7-5-4-2-1-3-8-6(4)10-9-5/h1-3H,(H2,7,9) |
| Molecular Structure: | ![(C6H5N3O) ISOXAZOLO[5,4-B]PYRIDIN-3-AMINE;ISOXAZOLO[5,4-B]PYRIDIN-3-YLAMINE](https://img1.guidechem.com/chem/e/dict/139/92914-74-4.jpg) |
| Properties | |
| Melting Point: | 212-214°C |
| Flash Point: | 157.4°C |
| Boiling Point: | 336.6°Cat760mmHg |
| Density: | 1.421g/cm3 |
| Refractive index: | 1.701 |
| Specification: | Safety Statements:26-36/37/39 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 36/37/39:Wear suitable protective clothing, gloves and eye/face protection |
| Flash Point: | 157.4°C |
| Safety Data | |
 |
|
