| Identification |
| Name: | Benzaldehyde,2,5-dimethoxy- |
| Synonyms: | NSC 6315;Benzaldehyde, 2,5-dimethoxy-; |
| CAS: | 93-02-7 |
| EINECS: | 202-211-5 |
| Molecular Formula: | C9H10O3 |
| Molecular Weight: | 166.18 |
| InChI: | InChI=1/C9H10O3/c1-11-8-3-4-9(12-2)7(5-8)6-10/h3-6H,1-2H3 |
| Molecular Structure: |
 |
| Properties |
| Density: | 1.114 g/cm3 |
| Stability: | Stable at room temperature in closed containers under normal storage and handling conditions. |
| Water Solubility: | Miscible with water |
| Solubility: | Miscible with water |
| Appearance: | colorless liquid. |
| Packinggroup: | I; II; III |
| HS Code: | 29124900 |
| Storage Temperature: | Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Sensitive: | Air Sensitive |
| Safety Data |
| Hazard Symbols |
Xi:Irritant
|
| |
 |
