| Identification |
| Name: | Benzenemethanol,3,4-dimethoxy- |
| Synonyms: | Veratrylalcohol (6CI,7CI,8CI);(3,4-Dimethoxyphenyl)methanol;3,4-Dimethoxybenzenemethanol;3,4-Dimethoxyphenylmethylalcohol;NSC 6317;Veratralcohol; |
| CAS: | 93-03-8 |
| EINECS: | 202-212-0 |
| Molecular Formula: | C9H12O3 |
| Molecular Weight: | 168.19 |
| InChI: | InChI=1/C9H12O3/c1-11-8-4-3-7(6-10)5-9(8)12-2/h3-5,10H,6H2,1-2H3 |
| Molecular Structure: |
 |
| Properties |
| Density: | 1.157 |
| Stability: | Unstable. Self ignition is possible. |
| Refractive index: | 1.551-1.554 |
| Water Solubility: | miscible |
| Solubility: | miscible |
| Appearance: | Unstable solid that is commonly blended with calcium carbonate and silica. |
| Storage Temperature: | Regrigerate. Keep in a tightly closed container. |
| Safety Data |
| Hazard Symbols |
Xn: Harmful
|
| |
 |
