| Identification | |
| Name: | Eugenol methyl ether;1,2-Dimethoxy-4-allylbenzene |
| Synonyms: | Methyleugenol; 1,2-Dimethoxy-4-(2-propenyl)benzene; 4-Allyl-1,2-dimethoxybenzene; 4-Allylveratrole |
| CAS: | 93-15-2 |
| EINECS: | 202-223-0 |
| Molecular Formula: | C11H14O2 |
| Molecular Weight: | 178.23 |
| InChI: | InChI=1/C11H14O2/c1-4-5-9-6-7-10(12-2)11(8-9)13-3/h4,6-8H,1,5H2,2-3H3 |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.035 |
| Stability: | Stable. Combustible. Incompatible with strong oxidizing agents. |
| Refractive index: | 1.533-1.535 |
| Water Solubility: | insoluble |
| Solubility: | insoluble in water |
| Appearance: | Light yellow liquid |
| HS Code: | 29093090 |
| Storage Temperature: | Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Color: | Crystals from hexane Colorless to pale yellow liquid |
| Usage: | Insect attractant, flavoring agent. |
| Safety Data | |
| Hazard Symbols |
Xn:Harmful
|
 |
|
