| Identification | |
| Name: | 3,4-Dimethoxy phenyl acetonitrile |
| Synonyms: | Homoveratronitrile; Veratryl cyanide; 3,4-Dimethoxyphenylacetonitrile; 3,4-Dimethoxybenzyl cyanide; TIMTEC-BB SBB005899; 3,4-dimethoxy-benzeneacetonitril; 3,4-dimethoxybenzeneacetonitrile; 3,4-dimethoxybenzyl; 3,4-dimethoxyphenyl-acetonitril; Acetonitrile, (3,4-dimethoxyphenyl)-; HOMOVERATONITRILE; 3,5-DIMETHOXY-BENZENEACETONITRILE; 3,4-Dimethyloxy Phenylacetonotrile; 3,4-dimethoxy phenylacetonitrile; (3,4-Dimethoxyphenyl)acetonitrile Veratryl; (3,4-Dimethoxyphenyl)acetonitrile |
| CAS: | 93-17-4 |
| EINECS: | 202-225-1 |
| Molecular Formula: | C10H11NO2 |
| Molecular Weight: | 177.2 |
| InChI: | InChI=1/C10H11NO2/c1-12-9-4-3-8(5-6-11)7-10(9)13-2/h3-4,7H,5H2,1-2H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | 3276 |
| Density: | 1.082 g/cm3 |
| Stability: | Stable under normal temperatures and pressures. |
| Refractive index: | 1.511 |
| Water Solubility: | insoluble |
| Solubility: | insoluble in water,methanol: 0.1 g/mL, clear |
| Appearance: | White crystal |
| Report: |
Cyanide and its compounds are on the Community Right-To-Know List. |
| Packinggroup: | I; II; III |
| Storage Temperature: | Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Color: | yellow |
| Safety Data | |
| Hazard Symbols |
T:Toxic
Xn:Harmful
|
 |
|
