| Identification | |
| Name: | Benzeneacetic acid,2-methoxy- |
| Synonyms: | Aceticacid, (o-methoxyphenyl)- (6CI,7CI,8CI);(o-Methoxyphenyl)acetic acid;2-Methoxybenzeneacetic acid;NSC 110708;NSC 16257;o-Anisylacetic acid; |
| CAS: | 93-25-4 |
| EINECS: | 202-231-4 |
| Molecular Formula: | C9H10O3 |
| Molecular Weight: | 166.18 |
| InChI: | InChI=1/C9H10O3/c1-12-8-5-3-2-4-7(8)6-9(10)11/h2-5H,6H2,1H3,(H,10,11) |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.179 g/cm3 |
| Stability: | Stable under normal temperatures and pressures. |
| Water Solubility: | SOLUBLE |
| Solubility: | Soluble in water |
| Appearance: | white to slightly pink-cream crystalline powder |
| Specification: |
2-Methoxyphenylacetic acid (CAS NO.93-25-4) is also named as (o-Methoxyphenyl)acetic acid ; NSC 110708 ; Acetic acid, (o-methoxyphenyl)- (8CI) ; Benzeneacetic acid, 2-methoxy- . 2-Methoxyphenylacetic acid (CAS NO.93-25-4) is white to slightly pink-cream crystalline powder. |
| HS Code: | 29189090 |
| Storage Temperature: | Store at RT. |
| Safety Data | |
| Hazard Symbols |
Xi: Irritant
|
 |
|
