| Identification | |
| Name: | 2-Naphthyl benzoate |
| Synonyms: | 2-Naphthalenol,benzoate (9CI);2-Naphthol, benzoate (6CI,7CI,8CI);2-Benzoyloxynaphthalene;Benzonaphthol;Betabenzon;NSC 5537;Naphthalen-2-ylbenzoate;b-Naphthyl benzoate;2-Naphthalenol,2-benzoate; |
| CAS: | 93-44-7 |
| EINECS: | 202-247-1 |
| Molecular Formula: | C17H12O2 |
| Molecular Weight: | 248.28 |
| InChI: | InChI=1/C17H12O2/c18-17(14-7-2-1-3-8-14)19-16-11-10-13-6-4-5-9-15(13)12-16/h1-12H |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 175 |
| Boiling Point: | 414 |
| Density: | 1.0768 - 1.1136 g/cm3 (160 - 110 C) |
| Stability: | Stable under normal temperatures and pressures. |
| Refractive index: | 1.652 |
| Water Solubility: | insoluble |
| Solubility: | insoluble |
| Appearance: | Light brown crystalline powder. |
| Specification: |
2-Naphthyl Benzoate (93-44-7),which also can be called for Benzoic Acid 2-Naphthyl Ester ; Benzonaphthol ; Beta-Naphthyl Benzoate ; Beta-Naphthyl Benzoate ; 2 Benzoxynaphthalene ; 2-Naphthol Bezoate ; 2-Naphthyl Benzoate ; 2-Benzoyloxy Naphthalene . 2-Naphthyl Benzoate (93-44-7) is a kind of light brown crystalline powder. This chemical is stable under normal temperatures and pressures.After decomposition it turned into Carbon Monoxide and Carbon Dioxide . 2-Naphthyl Benzoate (93-44-7) should be stored in a tightly closed container of cool,dry places. When you are handling this chemical,take care of avoid breathing dust, vapor, mist, or gas. Avoid contact with skin and eyes. |
| Flash Point: | 175 |
| Storage Temperature: | Store in a cool, dry place. Store in a tightly closed container. |
| Usage: | Hardening agent for paraffin. |
| Safety Data | |
 |
|
