| Identification | |
| Name: | AAOT |
| Synonyms: | Acetoacet-o-toluidide; N-(2-Methylphenyl)-3-oxo-butanamide; 2'-Methylacetoacetanilide; O-Methyl-N-Acetoacetyl Aniline; O-Acetoacetotoluidide; N-ACETOACETYL-O-TOLUIDINE; 2-Methylacetoacetanilide |
| CAS: | 93-68-5 |
| EINECS: | 202-267-0 |
| Molecular Formula: | C11H13NO2 |
| Molecular Weight: | 191.23 |
| InChI: | InChI=1/C11H13NO2/c1-8-5-3-4-6-10(8)12-11(14)7-9(2)13/h3-6H,7H2,1-2H3,(H,12,14) |
| Molecular Structure: |  |
| Properties | |
| Transport: | 25kgs |
| Boiling Point: | Decomposes |
| Density: | 1.06 |
| Stability: | Stable under normal temperatures and pressures. |
| Refractive index: | 1.56 |
| Water Solubility: | Slightly AUTOIGNITION |
| Solubility: | Slightly AUTOIGNITION |
| Appearance: | White to off white powder |
| Storage Temperature: | Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Usage: | Acetoacet-o-toluidide is used as intermediate for the manufacture of organic pigments as well as for the manufacture of agrochemicals. |
| Safety Data | |
| Hazard Symbols |
Xn:Harmful
|
 |
|
