| Identification | |
| Name: | Ethyl benzoate |
| Synonyms: | Benzoyl ethyl ether;Ethyl benzenecarboxylate;AI3-01352;Benzoic acid, ethyl ester;Benzoic ether;Ethyl benzoate (natural);Ethylester kyseliny benzoove;Ethylester kyseliny benzoove [Czech];FEMA No. 2422;NSC 8884; |
| CAS: | 93-89-0 |
| EINECS: | 202-284-3 |
| Molecular Formula: | C9H10O2 |
| Molecular Weight: | 150.17 |
| InChI: | InChI=1/C9H10O2/c1-2-11-9(10)8-6-4-3-5-7-8/h3-7H,2H2,1H3 |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.045 |
| Stability: | Stable. Combustible. Incompatible with strong oxidizing agents. |
| Refractive index: | 1.504-1.506 |
| Water Solubility: | INSOLUBLE |
| Solubility: | INSOLUBLE |
| Appearance: | clear, colorless to pale yellow liquid |
| Report: |
Reported in EPA TSCA Inventory. |
| Packinggroup: | II; III |
| HS Code: | 29163100 |
| Storage Temperature: | Keep away from heat, sparks, and flame. Keep away from sources of ignition. Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Usage: | Substance is used in as a perfume scent under the name essence de niobe. |
| Safety Data | |
 |
|
