| Identification |
| Name: | Benzoicacid, 1,1'-anhydride |
| Synonyms: | Benzoicacid, anhydride (9CI);Benzoic anhydride (8CI);Benzoylbenzoate;NSC 37116; |
| CAS: | 93-97-0 |
| EINECS: | 202-291-1 |
| Molecular Formula: | C14H10O3 |
| Molecular Weight: | 226.23 |
| InChI: | InChI=1/C14H10O3/c15-13(11-7-3-1-4-8-11)17-14(16)12-9-5-2-6-10-12/h1-10H |
| Molecular Structure: |
 |
| Properties |
| Density: | 1.199 |
| Stability: | Stable at room temperature in closed containers under normal storage and handling conditions. |
| Refractive index: | 1.57665 (20 C) |
| Water Solubility: | 0.01 g/L |
| Solubility: | 0.01 g/L |
| Appearance: | White to off-white flakes |
| Packinggroup: | I; II; III |
| HS Code: | 29163900 |
| Storage Temperature: | Store at RT. |
| Sensitive: | Moisture Sensitive |
| Usage: | Substance is used in organic syntheses, as benzoylating agent in the manufacture of pharmaceuticals, dyes, and intermediates. |
| Safety Data |
| Hazard Symbols |
Xi:Irritant
|
| |
 |
