| Identification | |
| Name: | Phenyl benzoate |
| Synonyms: | - |
| CAS: | 93-99-2 |
| EINECS: | 202-293-2 |
| Molecular Formula: | C13H10O2 |
| Molecular Weight: | 198.22 |
| InChI: | InChI=1/C13H10O2/c14-13(11-7-3-1-4-8-11)15-12-9-5-2-6-10-12/h1-10H |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.146g/cm3 |
| Stability: | Stable. Incompatible with strong oxidizing agents, strong acids, strong bases. |
| Refractive index: | 1.584 |
| Water Solubility: | Stability Stable. Incompatible with strong oxidizing agents,strong acids, strong bases. Toxicology Harmful if swallowed. Skin irritant. Toxicity data (The meani |
| Solubility: |
|
| Appearance: | white crystalline powder |
| Report: |
Reported in EPA TSCA Inventory. |
| Safety Data | |
| Hazard Symbols |
Xn:Harmful
|
 |
|
