Identification |
Name: | Ethanone,1-(1-methyl-1H-pyrrol-2-yl)- |
Synonyms: | Ketone,methyl 1-methylpyrrol-2-yl (6CI,7CI,8CI);1-(1-Methyl-1H-pyrrol-2-yl)ethanone;1-Methyl-2-acetylpyrrole;2-Acetyl-N-methylpyrrole;N-Methyl-2-acetylpyrrole;N-Methyl-2-pyrrolylethanone;NSC 87239; |
CAS: | 932-16-1 |
EINECS: | 213-247-6 |
Molecular Formula: | C7H9NO |
Molecular Weight: | 123.15 |
InChI: | InChI=1/C7H9NO/c1-6(9)7-4-3-5-8(7)2/h3-5H,1-2H3 |
Molecular Structure: |
|
Properties |
Density: | 1.04 |
Stability: | Stable under normal temperatures and pressures. |
Refractive index: | 1.54-1.544 |
Solubility: | Soluble |
Appearance: | Clear yellow liquid. |
Storage Temperature: | Keep away from heat, sparks, and flame. Keep away from sources of ignition. Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
Safety Data |
|
|