| Identification |
| Name: | Ethanone,1-(1-methyl-1H-pyrrol-2-yl)- |
| Synonyms: | Ketone,methyl 1-methylpyrrol-2-yl (6CI,7CI,8CI);1-(1-Methyl-1H-pyrrol-2-yl)ethanone;1-Methyl-2-acetylpyrrole;2-Acetyl-N-methylpyrrole;N-Methyl-2-acetylpyrrole;N-Methyl-2-pyrrolylethanone;NSC 87239; |
| CAS: | 932-16-1 |
| EINECS: | 213-247-6 |
| Molecular Formula: | C7H9NO |
| Molecular Weight: | 123.15 |
| InChI: | InChI=1/C7H9NO/c1-6(9)7-4-3-5-8(7)2/h3-5H,1-2H3 |
| Molecular Structure: |
 |
| Properties |
| Density: | 1.04 |
| Stability: | Stable under normal temperatures and pressures. |
| Refractive index: | 1.54-1.544 |
| Solubility: | Soluble |
| Appearance: | Clear yellow liquid. |
| Storage Temperature: | Keep away from heat, sparks, and flame. Keep away from sources of ignition. Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Safety Data |
| |
 |
