| Identification |
| Name: | 2,4(1H,3H)-Pyrimidinedione,5-amino- |
| Synonyms: | Uracil,5-amino- (6CI,8CI);2,4-Dihydroxy-5-aminopyrimidine;5-Amino-2,4(1H,3H)-pyrimidinedione;5-Amino-2,4-dihydroxypyrimidine;5-Amino-2,4-pyrimidinediol;NSC 22474; |
| CAS: | 932-52-5 |
| EINECS: | 213-252-3 |
| Molecular Formula: | C4H5N3O2 |
| Molecular Weight: | 127.1 |
| InChI: | InChI=1/C4H5N3O2/c5-2-1-6-4(9)7-3(2)8/h1H,5H2,(H2,6,7,8,9) |
| Molecular Structure: |
 |
| Properties |
| Density: | 1.406 g/cm3 |
| Stability: | Stable under normal shipping and handling conditions. |
| Refractive index: | 1.544 |
| Solubility: | 0.5 g/L (20 ºC) in water |
| Appearance: | tan powder |
| Storage Temperature: | Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. Do not expose to air. Store under an inert atmosphere. |
| Safety Data |
| |
 |
