| Identification | |
| Name: | Benzene, (dichloriodo)- |
| Synonyms: | Benzene,(dichloroiodo)- (7CI,8CI);Benzene, iodo-, dichloride (6CI);Iodine,dichlorophenyl- (9CI);(Dichloroiodo)benzene;Chlorophenyliodonium chloride;Dichlorophenyliodine;Iodobenzene dichloride;NSC 149834;Phenyliodosochloride;Phenylchloroiodonium chloride;Phenyliodine dichloride;Phenyliodonium dichloride;Phenyliodoso dichloride;dichloro(phenyl)-λ3-iodane; |
| CAS: | 932-72-9 |
| Molecular Formula: | C6H5Cl2I |
| Molecular Weight: | 274.9144 |
| InChI: | InChI=1/C6H5Cl2I/c7-9(8)6-4-2-1-3-5-6/h1-5H |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.338 |
| Refractive index: | 1.532 |
| Specification: | Safety Statements:26-36 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 36:Wear suitable protective clothing |
| Safety Data | |
| Hazard Symbols |
Xi: Irritant
|
 |
|
