Identification |
Name: | 2-Fluoro-5-methylbenzaldehyde |
Synonyms: | Benzaldehyde, 2-fluoro-5-methyl-;6-Fluoro-m-tolualdehyde; |
CAS: | 93249-44-6 |
Molecular Formula: | C8H7FO |
Molecular Weight: | 138.14 |
InChI: | InChI=1/C8H7FO/c1-6-2-3-8(9)7(4-6)5-10/h2-5H,1H3 |
Molecular Structure: |
|
Properties |
Transport: | UN 3265 |
Flash Point: | 178? |
Density: | 1.129 |
Refractive index: | 1.5160 |
Appearance: | Light yellow or a colourless liquid |
Specification: | Safety Statements:26-27-36/37/39-45 26:In case of contact with eyes, rinse immediately with plenty
of water and seek medical advice 27:Take off immediately all contaminated clothing 36/37/39:Wear suitable protective clothing, gloves and eye/face
protection 45:In case of accident or if you feel unwell, seek medical
advice immediately (show label where possible) |
Flash Point: | 178? |
Storage Temperature: | Room temperature. |
Sensitive: | Air Sensitive |
Safety Data |
Hazard Symbols |
C:Corrosive
|
|
|