| Identification | |
| Name: | o-Toluoyl chloride |
| Synonyms: | 2-Methylbenzoyl chloride; Toluoylchloride; 98%; ortho-toluoyl chloride |
| CAS: | 933-88-0 |
| EINECS: | 213-273-8 |
| Molecular Formula: | C8H7ClO |
| Molecular Weight: | 154.6 |
| InChI: | InChI=1/C8H7ClO/c1-6-4-2-3-5-7(6)8(9)10/h2-5H,1H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 3265 8 |
| Melting Point: | -18 |
| Density: | 1.185 |
| Stability: | Stable under normal temperatures and pressures. Moisture sensitive. |
| Refractive index: | 1.554-1.556 |
| Water Solubility: | Decomposes in water |
| Solubility: | Decomposes in water |
| Appearance: | light yellow clear liquid. |
| Specification: | clear pale yellow to yellow to faintly pink liquid Safety Statements:23-26-27-36/37/39-45-24/25 23:Do not breathe gas/fumes/vapor/spray (appropriate wording to be specified by the manufacturer) 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 27:Take off immediately all contaminated clothing 36/37/39:Wear suitable protective clothing, gloves and eye/face protection 45:In case of accident or if you feel unwell, seek medical advice immediately (show label where possible) 24/25:Avoid contact with skin and eyes |
| Packinggroup: | II |
| HS Code: | 29163900 |
| Storage Temperature: | Keep away from heat, sparks, and flame. Keep away from sources of ignition. Keep container closed when not in use. Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. Corrosives area. Store protected from moisture. |
| Sensitive: | Moisture Sensitive |
| Safety Data | |
| Hazard Symbols |
C:Corrosive
|
 |
|
