| Identification | |
| Name: | 1-[Cyano-(p-methoxyphenyl)methyl]cyclohexanol |
| Synonyms: | 1-[Cyano(4-methoxyphenyl)methyl]cyclohexanol; |
| CAS: | 93413-76-4 |
| Molecular Formula: | C15H19NO2 |
| Molecular Weight: | 245.32 |
| InChI: | InChI=1/C15H19NO2/c1-18-13-7-5-12(6-8-13)14(11-16)15(17)9-3-2-4-10-15/h5-8,14,17H,2-4,9-10H2,1H3 |
| Molecular Structure: | ![(C15H19NO2) 1-[Cyano(4-methoxyphenyl)methyl]cyclohexanol;](https://img.guidechem.com/casimg/93413-76-4.gif) |
| Properties | |
| Flash Point: | 201.849 ºC |
| Boiling Point: | 410.146 ºC at 760 mmHg |
| Density: | 1.142 g/cm3 |
| Refractive index: | 1.561 |
| Appearance: | Colorless and transparent liquid |
| Specification: |
1-[Cyano-(p-methoxyphenyl)methyl]cyclohexanol (CAS NO.93413-76-4), its Synonyms are 1-[Cyano(4-methoxyphenyl)methyl]cyclohexanol ; 1-[Cyno-(4-methoxyphenyl)methyl]cyclohexanol(VF1) ; 1-Hydroxycyclohexyl-4-methoxyphenylacetonitrile(forvenlafaxineHCl) ; alpha-(1-Hydroxycyclohexyl)-4-methoxybenzeneacetonitrile . It is white powder. |
| Flash Point: | 201.849 ºC |
| Usage: | An intermediate in the synthesis of N,O-Didesmethylvenlafaxine, a metabolite of Venlafaxine |
| Safety Data | |
 |
|
