| Identification | |
| Name: | 1,3-Isobenzofurandione,3a,4,7,7a-tetrahydro-, (3aR,7aS)-rel- |
| Synonyms: | 1,3-Isobenzofurandione,3a,4,7,7a-tetrahydro-, cis-; 4-Cyclohexene-1,2-dicarboxylic anhydride, cis- (8CI);NSC 49672; cis-1,2,3,6-Tetrahydrophthalic acid anhydride;cis-1,2,3,6-Tetrahydrophthalic anhydride; cis-4-Cyclohexene-1,2-dicarboxylicacid anhydride; cis-4-Cyclohexene-1,2-dicarboxylic anhydride; cis-D4-Tetrahydrophthalic anhydride |
| CAS: | 935-79-5 |
| EINECS: | 213-308-7 |
| Molecular Formula: | C8H8 O3 |
| Molecular Weight: | 152.15 . CODE |
| InChI: | InChI=1S/C8H8O3/c9-7-5-3-1-2-4-6(5)8(10)11-7/h1-2,5-6H,3-4H2/t5-,6+ |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 2698 |
| Melting Point: | 101 - 102 C |
| Flash Point: | 156 ºC |
| Boiling Point: | 305.6 °C at 760 mmHg |
| Density: | 1.289 |
| Stability: | Stable under normal temperatures and pressures. May decompose on exposure to moist air or water. |
| Water Solubility: | Reacts AUTOIGNITION |
| Solubility: | Reacts AUTOIGNITION |
| Appearance: | White to light yellow flakes |
| Specification: |
1,3-Isobenzofurandione, 3a,4,7,7a-tetrahydro-, (3aR,7aS)-rel- (CAS NO.935-79-5) is also called as AI3-23866 ; EINECS 213-308-7 ; NSC 49672 ; cis-3a,4,7,7a-Tetrahydro-1,3-isobenzofurandione ; 1,3-Isobenzofurandione, 3a,4,7,7a-tetrahydro-, cis- ; cis-1,2,3,6-Tetrahydrophthalic anhydride . |
| Packinggroup: | III |
| Flash Point: | 156 ºC |
| Storage Temperature: | Keep container closed when not in use. Store protected from moisture. |
| Sensitive: | Moisture Sensitive |
| Safety Data | |
| Hazard Symbols |
Xn: Harmful
|
 |
|
