| Identification | |
| Name: | Salicylhydrazide |
| Synonyms: | Salicylic acid hydrazide; salicylic hydrazide; Salicyloyl hydrazide; salicylohydrazide; 2-Hydroxybenzhydrazide; o-Hydroxybenzoylhydrazine; 2-Hydroxybenzoic hydrazide |
| CAS: | 936-02-7 |
| EINECS: | 213-311-3 |
| Molecular Formula: | C7H8N2O2 |
| Molecular Weight: | 152.15 |
| InChI: | InChI=1/C7H8N2O2/c8-9-7(11)5-3-1-2-4-6(5)10/h1-4,10H,8H2,(H,9,11) |
| Molecular Structure: |  |
| Properties | |
| Transport: | HAZARD |
| Flash Point: | °C |
| Boiling Point: | °Cat760mmHg |
| Density: | 1.318g/cm3 |
| Stability: | Stable under normal temperatures and pressures. |
| Refractive index: | 1.622 |
| Water Solubility: | AUTOIGNITION |
| Solubility: | AUTOIGNITION |
| Appearance: | white to off-white crystalline powder |
| Specification: |
Store in a cool, dry place. Keep container closed when not in use.Wash thoroughly after handling. Remove contaminated clothing and wash before reuse. Avoid contact with eyes, skin, and clothing. Avoid ingestion and inhalation. |
| Report: |
Reported in EPA TSCA Inventory. |
| Flash Point: | °C |
| Storage Temperature: | Store in a cool, dry place. Keep container closed when not in use. |
| Usage: | Abiotic elicitor. |
| Safety Data | |
| Hazard Symbols |
Xi:Irritant
|
 |
|
