| Identification |
| Name: | 1-Propanone,3-chloro-1-phenyl- |
| Synonyms: | Propiophenone,3-chloro- (7CI,8CI);1-Phenyl-3-chloro-1-propanone;2-Chloroethyl phenylketone;3-Chloro-1-phenyl-1-propanone;NSC 227202;NSC37238;b-Chloroethyl phenyl ketone;b-Chloropropiophenone;w-Chloropropiophenone; |
| CAS: | 936-59-4 |
| EINECS: | 213-317-6 |
| Molecular Formula: | C9H9ClO |
| Molecular Weight: | 168.62 |
| InChI: | InChI=1/C9H9ClO/c10-7-6-9(11)8-4-2-1-3-5-8/h1-5H,6-7H2 |
| Molecular Structure: |
 |
| Properties |
| Density: | 1.132g/cm3 |
| Stability: | Stable. Incompatible with strong bases, strong oxidizing agents. |
| Refractive index: | 1.5578 (20 C) |
| Water Solubility: | Insoluble |
| Solubility: | Insoluble |
| Appearance: | faintly yellow to tan crystalline powder |
| Storage Temperature: | Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Safety Data |
| Hazard Symbols |
Xi:Irritant
|
| |
 |
