| Identification |
| Name: | Ethanone,1-(4-ethylphenyl)- |
| Synonyms: | Acetophenone,4'-ethyl- (6CI,7CI,8CI);Acetophenone, p-ethyl- (4CI);1-(4-Ethylphenyl)ethanone;1-Acetyl-4-ethylbenzene;NSC6768;p-Acetylethylbenzene;p-Ethyl-hypnone;p-Ethylacetophenone;p-Ethylphenylmethyl ketone; |
| CAS: | 937-30-4 |
| EINECS: | 213-326-5 |
| Molecular Formula: | C10H12O |
| Molecular Weight: | 148.2 |
| InChI: | InChI=1/C10H12O/c1-3-9-4-6-10(7-5-9)8(2)11/h4-7H,3H2,1-2H3 |
| Molecular Structure: |
 |
| Properties |
| Density: | 0.993 |
| Stability: | Stable under normal temperatures and pressures. |
| Refractive index: | 1.5283-1.5303 |
| Water Solubility: | Soluble in benzene, toluene, ethylbenzene, etc. |
| Solubility: | Soluble in benzene, toluene, ethylbenzene, etc. |
| Appearance: | Colorless or pale yellow liquid |
| Storage Temperature: | Keep away from heat, sparks, and flame. Keep away from sources of ignition. Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Usage: | Intermediates of Liquid Crystals |
| Safety Data |
| |
 |
