| Identification | ||
| Name: | Benzamide, 2-ethoxy- | |
| Synonyms: | Ethenzamide;o-Ethoxybenzamide; | |
| CAS: | 938-73-8 | |
| EINECS: | 213-346-4 | |
| Molecular Formula: | C9H11NO2 | |
| Molecular Weight: | 165.19 | |
| InChI: | InChI=1/C9H11NO2/c1-2-12-8-6-4-3-5-7(8)9(10)11/h3-6H,2H2,1H3,(H2,10,11) | |
| Molecular Structure: |  |
|
| Properties | ||
| Density: | 1.111 g/cm3 | |
| Stability: | Stable at room temperature in closed containers under normal storage and handling conditions. | |
| Refractive index: | 1.538? | |
| Water Solubility: | <0.1 g/100 mL at 16 ºC | |
| Solubility: | <0.1 g/100 mL at 16 oC | |
| Appearance: | White or almost-white crystalline powder. Almost odorless. Tasteless. | |
| Specification: | WHITE TO ALMOST WHITE GRANULAR CRYSTALLINE POWDER Safety Statements:24/25 24/25:Avoid contact with skin and eyes | |
| HS Code: | 29242995 | |
| Storage Temperature: | Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. No special precautions indicated. | |
| Safety Data | ||
 |
||
