| Identification | |
| Name: | 2-(Bromomethyl)naphthalene |
| Synonyms: | 2-Naphthylmethyl bromide; 2-Bromomethylnaphthalene; 2-Bromomethyl naphthalene; |
| CAS: | 939-26-4 |
| EINECS: | 213-359-5 |
| Molecular Formula: | C11H9Br |
| Molecular Weight: | 221.1 |
| InChI: | InChI=1/C11H9Br/c12-8-9-5-6-10-3-1-2-4-11(10)7-9/h1-7H,8H2 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 3261 |
| Flash Point: | 213 oC (100 mmHg) |
| Density: | 1.444g/cm3 |
| Stability: | Stable under normal temperatures and pressures. |
| Refractive index: | 1.663 |
| Solubility: | Insoluble |
| Appearance: | Almost white powder. |
| Specification: | White to cream solid Safety Statements:26-28-36/37/39-45-37-27 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 28:After contact with skin, wash immediately with plenty of ... (to be specified by the manufacturer) 36/37/39:Wear suitable protective clothing, gloves and eye/face protection 45:In case of accident or if you feel unwell, seek medical advice immediately (show label where possible) 37:Wear suitable gloves 27:Take off immediately all contaminated clothing |
| Packinggroup: | II |
| HS Code: | 29033036 |
| Flash Point: | 213 oC (100 mmHg) |
| Safety Data | |
| Hazard Symbols |
C:Corrosive
|
 |
|
