| Identification | |
| Name: | Naphthalene, 2-ethyl- |
| Synonyms: | 2-Ethylnaphthalene;3-Ethylnaphthalene; NSC 59389; b-Ethylnaphthalene |
| CAS: | 939-27-5 |
| EINECS: | 213-360-0 |
| Molecular Formula: | C12H12 |
| Molecular Weight: | 156.24 |
| InChI: | InChI=1/C12H12/c1-2-10-7-8-11-5-3-4-6-12(11)9-10/h3-9H,2H2,1H3 |
| Molecular Structure: |  |
| Properties | |
| Melting Point: | −70 °C(lit.) |
| Flash Point: | 104.4°C |
| Boiling Point: | 251-252 °C(lit.) |
| Density: | 0.999g/cm3 |
| Stability: | Stable. Combustible. Incompatible with strong oxidizing agents. |
| Refractive index: | n20/D 1.599(lit.) |
| Water Solubility: | Stability Stable. Combustible. Incompatible with strongoxidizing agents. Toxicology Not hazardous according to Directive 67/548/EEC. Toxicity data (The meaning o |
| Solubility: |
|
| Appearance: | colourless liquid |
| Specification: |
2-Ethylnaphthalene ,its CAS NO. is 939-27-5,the synonyms is beta-Ethylnaphthalene ; Naphthalene, 2-ethyl- . |
| Flash Point: | 104.4°C |
| Safety Data | |
 |
|
