| Identification |
| Name: | isooctadecanoic acid, compound with 1,1'-iminodi(propan-2-ol) (1:1) |
| Synonyms: | Isooctadecanoic acid, compd. with 1,1'-iminobis(2-propanol) (1:1);Isooctadecanoic acid, compound with 1,1'-iminodi(propan-2-ol) (1:1);16-methylheptadecanoic acid - 1,1'-iminodipropan-2-ol (1:1) |
| CAS: | 93920-27-5 |
| EINECS: | 300-112-2 |
| Molecular Formula: | C24H51NO4 |
| Molecular Weight: | 417.666 |
| InChI: | InChI=1/C18H36O2.C6H15NO2/c1-17(2)15-13-11-9-7-5-3-4-6-8-10-12-14-16-18(19)20;1-5(8)3-7-4-6(2)9/h17H,3-16H2,1-2H3,(H,19,20);5-9H,3-4H2,1-2H3 |
| Molecular Structure: |
 |
| Properties |
| Flash Point: | 225.6°C |
| Boiling Point: | 400.8°C at 760 mmHg |
| Density: | g/cm3 |
| Flash Point: | 225.6°C |
| Safety Data |
| |
 |
