| Identification | |
| Name: | 1H-Indole,3-(4-fluorophenyl)-1-(1-methylethyl)- |
| Synonyms: | 1-Isopropyl-3-(4-fluorophenyl)indole;3-(4-Fluorophenyl)-1-(1-methylethyl)-1H-indole;3-(4-Fluorophenyl)-1-(1-methylethyl)-1H-indol; |
| CAS: | 93957-49-4 |
| EINECS: | 418-790-4 |
| Molecular Formula: | C17H16FN |
| Molecular Weight: | 253.31 |
| InChI: | InChI=1/C17H16FN/c1-12(2)19-11-16(13-7-9-14(18)10-8-13)15-5-3-4-6-17(15)19/h3-12H,1-2H3 |
| Molecular Structure: |  |
| Properties | |
| Melting Point: | 95-98ºC |
| Flash Point: | 189.4ºC |
| Boiling Point: | 389.6ºC at 760 mmHg |
| Density: | 1.08 g/cm3 |
| Refractive index: | 1.573 |
| Appearance: | off-white crystal |
| Specification: | Off-White Crystalline Solid Safety Statements:26-36-61 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 36:Wear suitable protective clothing 61:Avoid release to the environment. Refer to special instructions safety data sheet |
| Flash Point: | 189.4ºC |
| Storage Temperature: | Room temperature. |
| Safety Data | |
| Hazard Symbols |
Xi: Irritant
|
 |
|
