| Identification | |
| Name: | Ethyl benzoyl acetate |
| Synonyms: | Aceticacid, benzoyl-, ethyl ester (6CI,7CI,8CI);1-Ethoxy-3-phenylpropane-1,3-dione;3-Oxo-3-phenylpropanoic acid ethyl ester;3-Oxo-3-phenylpropionic acid ethylester;3-Phenyl-3-oxopropanoic acid ethyl ester;Benzoylacetic acid ethylester;Ethyl 2-benzoylacetate;Ethyl 3-oxo-3-phenylpropanoate;Ethyl3-oxo-3-phenylpropionate;Ethyl 3-phenyl-3-oxopropanoate;Ethyl benzoylacetate;Ethyl b-oxobenzenepropanoate;NSC 227214;NSC6774;b-Oxobenzenepropanoic acid ethyl ester; |
| CAS: | 94-02-0 |
| EINECS: | 202-295-3 |
| Molecular Formula: | C11H12O3 |
| Molecular Weight: | 192.21 |
| InChI: | InChI=1/C11H12O3/c1-2-14-11(13)8-10(12)9-6-4-3-5-7-9/h3-7H,2,8H2,1H3 |
| Molecular Structure: |  |
| Properties | |
| Melting Point: | < 0 |
| Density: | 1.106 |
| Stability: | Substance may undergo color change upon exposure to light and air. Volatile in steam. |
| Refractive index: | 1.524-1.531 |
| Water Solubility: | INSOLUBLE |
| Solubility: | insoluble in water |
| Appearance: | White to off white powder with a characteristic odor |
| Specification: |
General Information: As in any fire, wear a self-contained breathing apparatus in pressure-demand, MSHA/NIOSH (approved or equivalent), and full protective gear. |
| Report: |
Reported in EPA TSCA Inventory. |
| HS Code: | 29183000 |
| Storage Temperature: | Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. Do not expose to air. Store protected from light. Store under an inert atmosphere. |
| Sensitive: | Light Sensitive |
| Usage: | Ethyl benzoylacetate (Best) is used as intermediate for different organic synthesis. Product Data Sheet |
| Safety Data | |
 |
|
