| Identification | ||
| Name: | Ethyl (ethoxymethylene)cyanoacetate | |
| Synonyms: | Ethyl 2-cyano-3-ethoxyacrylate; Cis-1,2-Cyclohexanedicarboxylic Anhydride; 2-Cyano-3-ethoxy-2-propenoic acid ethyl ester; Ethyl ethoxymethylenecyanoacetate | |
| CAS: | 94-05-3 | |
| EINECS: | 202-299-5 | |
| Molecular Formula: | C8H11NO3 | |
| Molecular Weight: | 169.18 | |
| InChI: | InChI=1/C8H11NO3/c1-3-11-6-7(5-9)8(10)12-4-2/h6H,3-4H2,1-2H3/b7-6+ | |
| Molecular Structure: |  |
|
| Properties | ||
| Transport: | 3276 | |
| Density: | 1.075g/cm3 | |
| Stability: | No data. | |
| Refractive index: | 1.452 | |
| Water Solubility: | <0.01 g/L (20 ºC) | |
| Solubility: | <0.01 g/L (20 ºC) | |
| Appearance: | Faint yellow solid | |
| Specification: |
The ethyl 2-cyano-3-ethoxyacrylate , its cas register number is 94-05-3. It also can be called 2-Propenoic acid,2-cyano-3-ethoxy-, ethyl ester ; 2-Cyano-3-ethoxy-2-propenoic acid ethyl ester ; Acrylic acid, 2-cyano-3-ethoxy-, ethyl ester (8CI) .It is a white to light yellow crystalline solid. | |
| Packinggroup: | III | |
| Storage Temperature: | Store in a cool, dry place. Store in a tightly closed container. | |
| Safety Data | ||
| Hazard Symbols |
Xn:Harmful
|
|
 |
||
