| Identification |
| Name: | Synephrine |
| Synonyms: | Benzylalcohol, p-hydroxy-a-[(methylamino)methyl]-(8CI);1-(4-Hydroxyphenyl)-2-(methylamino)ethanol;1-(4-Hydroxyphenyl)-N-methylethanolamine;1-Hydroxy-4-[(1-hydroxy-2-methylamino)ethyl]benzene;Analeptin;DL-Synephrine;Ethaphene;N-[2-Hydroxy-2-(4-hydroxyphenyl)ethyl]-N-methylamine;NSC 166285;NSC 170956;Oxedrine;S 38537-9;Simpalon; |
| CAS: | 94-07-5 |
| EINECS: | 202-300-9 |
| Molecular Formula: | C9H13NO2 |
| Molecular Weight: | 167.23 |
| InChI: | InChI=1S/C9H13NO2/c1-10-6-9(12)7-2-4-8(11)5-3-7/h2-5,9-12H,6H2,1H3 |
| Molecular Structure: |
![(C9H13NO2) Benzylalcohol, p-hydroxy-a-[(methylamino)methyl]-(8CI);1-(4-Hydroxyphenyl)-2-(methylamino)ethanol;1-...](https://img1.guidechem.com/chem/e/dict/212/94-07-5.jpg) |
| Properties |
| Melting Point: | 187 oC |
| Density: | 1.159 g/cm3 |
| Stability: | Stable at normal temperatures and pressures. |
| Solubility: | Very soluble |
| Appearance: | off-white to beige powder |
| Specification: |
?Synephrine (CAS NO.94-07-5) is also named as?(-)-N-Methyloctopamine ; 1-(4-Hydroxyphenyl)-2-methylaminoethanol ; 1-(4-Hydroxyphenyl)-N-methylethanolamine ; 4-Hydroxy-alpha-((methylamino)methyl)benzenemethanol ; Analeptin ; DL-Synephrine ;?Ethaphene ; Methylaminomethyl(4-hydroxyphenyl)carbinol ; NSC 166285 ; NSC 170956 ; Oxedrine ; Parakorper ; Parakorper [German] ; Parasympatol ; Pentedrin ; Pentedrin [German] ; S 38537-9 ; alpha-(4-Oxyphenyl)alpha-oxy-beta-methylaminoaethan ; alpha-(4-Oxyphenyl)alpha-oxy-beta-methylaminoaethan [German] ; beta-Methylamino-alpha-(4-hydroxyphenyl)ethyl alcohol ; p-Hydroxy-alpha-((methylamino)methyl)benzyl alcohol ; p-Hydroxyphenylmethylaminoethanol ; p-Methylaminoethanolphenol ; p-Oxedrine ; p-Synephrine?; ( -)-N-Methyloctopamine ; 1-(4-Hydroxyphenyl)-2-methylaminoethanol ; alpha-(4-Oxyphenyl)alpha-oxy-beta-methylaminoaethan ; alpha-(4-Oxyphenyl)alpha-oxy-beta-methylaminoaethan [German] ; beta-Methylamino-alpha-(4-hydroxyphenyl)ethyl alcohol ; p-Hydroxy-alpha-((methylamino)methyl)benzyl alcohol ; p-Hydroxyphenylmethylaminoethanol ; p-Methylaminoethanolphenol ; p-Oxedrine
p-Synephrine .?Synephrine (CAS NO.94-07-5) is off-white to beige powder. It is?soluble in water, insoluble in ether, almost insoluble in chloroform, ether.
|
| Usage: | A a-adrenergic receptor agonist, vasoconstrictor |
| Safety Data |
| Hazard Symbols |
Xi: Irritant
|
| |
 |