| Identification | |
| Name: | benzoyl Peroxide |
| Synonyms: | Dibenzoyl peroxide; BPO; Perkadox L; Benzoyl peroxide paste |
| CAS: | 94-36-0 |
| EINECS: | 202-327-6 |
| Molecular Formula: | C14H10O4 |
| Molecular Weight: | 242.23 |
| InChI: | InChI=1/C14H10O4/c15-13(11-7-3-1-4-8-11)17-18-14(16)12-9-5-2-6-10-12/h1-10H |
| Molecular Structure: |  |
| Properties | |
| Transport: | HAZARD |
| Flash Point: | 50 C |
| Boiling Point: | explodes |
| Stability: | Strong oxidizer. Highly flammable. Do not grind or subject to shock or friction. Incompatible with reducing agents, acids, bases, alcohols, metals, organic materials. Contact with combustible material, heating or friction may cause fire or explosion. |
| Refractive index: | 1.543 (20 C) |
| Water Solubility: | Insoluble |
| Solubility: | slightly soluble AUTOIGNITION |
| Appearance: | white powder or clear solution |
| Packinggroup: | II |
| Flash Point: | 50 C |
| Color: | CRYSTALS WHITE, GRANULAR CRYSTALLINE SOLID Colorless to white crystals or a granular powder. |
| Usage: | Oxidizing agent in bleaching oils, flour, catalyst in the plastics industry, initiator in polymerization, source of free radicals for industrial processes. |
| Safety Data | |
| Hazard Symbols |
E:Explosive
|
 |
|
