| Identification | ||
| Name: | 6-Nitrobenzimidazole | |
| Synonyms: | 5-Nitro-1H-benzimidazole; 5-Nitrobenzimidazole nitrate salt | |
| CAS: | 94-52-0 | |
| EINECS: | 202-341-2 | |
| Molecular Formula: | C7H5N3O2 | |
| Molecular Weight: | 163.14 | |
| InChI: | InChI=1/C7H5N3O2/c11-10(12)5-1-2-6-7(3-5)9-4-8-6/h1-4H,(H,8,9) | |
| Molecular Structure: |  |
|
| Properties | ||
| Transport: | 25kgs | |
| Flash Point: | 241.5 ºC | |
| Boiling Point: | 475.7 ºC at 760 mmHg | |
| Density: | 1.525 g/cm3 | |
| Stability: | Stable. Combustible. Incompatible with strong oxidizing agents, strong bases. | |
| Refractive index: | 1.74 | |
| Water Solubility: | <0.01 g/100 mL at 16.5 ºC | |
| Solubility: | <0.01 g/100 mL at 16.5 ºC | |
| Appearance: | yellow to green crystals | |
| Specification: |
6-Nitrobenzimidazole (CAS NO.94-52-0) is also named 5(6)-nitrobenzimidazole ; 5-nitro-1h-benzimidazol ; 5-Nitro-1H-benzoimidazole ; 5-nitro-benzimidazol ; 6-nitro-benzimidazol ; Benzimidazole,5(or6)-nitro- ; Benzimidazole,5-nitro- . | |
| Report: |
NCI Carcinogenesis Bioassay (feed); Clear Evidence: mouse NCITR* National Cancer Institute Carcinogenesis Technical Report Series. (Bethesda, MD 20014) No. NCI-CG-TR-117 ,1978. ; (feed); Negative: rat NCITR* National Cancer Institute Carcinogenesis Technical Report Series. (Bethesda, MD 20014) No. NCI-CG-TR-117 ,1978. . Reported in EPA TSCA Inventory. | |
| HS Code: | 29339990 | |
| Flash Point: | 241.5 ºC | |
| Storage Temperature: | Store in a cool, dry place. Store in a tightly closed container. | |
| Color: | Solid NEEDLES FROM WATER | |
| Usage: | Antifogging agent in photographic developers. | |
| Safety Data | ||
| Hazard Symbols |
Xn:Harmful
|
|
 |
||
