| Identification | |
| Name: | N-Ethyl-o-toluidine |
| Synonyms: | 2-Ethylaminotoluene |
| CAS: | 94-68-8 |
| EINECS: | 202-354-3 |
| Molecular Formula: | C9H13N |
| Molecular Weight: | 135.21 |
| InChI: | InChI=1/C9H13N/c1-3-10-9-7-5-4-6-8(9)2/h4-7,10H,3H2,1-2H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | 2754 |
| Melting Point: | -15 |
| Density: | 0.938 |
| Refractive index: | 1.546-1.548 |
| Water Solubility: | insoluble |
| Solubility: | insoluble |
| Appearance: | clear yellow to green to brown liquid |
| Specification: |
N-ethyl-o-toluidine , with CAS number of 94-68-8, can be called 1-(Ethylamino)-2-methylbenzene ; 2-(Ethylamino)toluene ; N-Ethyl-2-methylaniline ; N-Ethyl-o-toluidine ; o-Methyl-N-ethylaniline ; Benzenamine, N-ethyl-2-methyl- ; o-Toluidine, N-ethyl- (8CI) . N-ethyl-o-toluidine (CAS NO.94-68-8) is clear yellow to green to brown liquid . N-ethyl-o-toluidine (CAS NO.94-68-8) is used f.or the dye, medicine and other organic synthesis. |
| Packinggroup: | II |
| Safety Data | |
| Hazard Symbols |
T:Toxic
|
 |
|
