| Identification | |
| Name: | 2,4-Dichlorophenoxyacetic acid |
| Synonyms: | amidox; b-selektonon; u-5043; crotilin; decamine; dicopur; dicotox; ipaner; netagrone; pennamine; weedone-2,4-dp; helena 2,4-d; 2,4-d lv6; weedar 64a; chloroxone; bh 2,4-d; agrotect; amoxone; weed tox; weedtrol; emulsamine bk; envert dt; dormone; 2,4-D |
| CAS: | 94-75-7 |
| EINECS: | 202-361-1 |
| Molecular Formula: | C8H6Cl2O3 |
| Molecular Weight: | 221.04 |
| InChI: | InChI=1/C8H6Cl2O3/c9-5-1-2-7(6(10)3-5)13-4-8(11)12/h1-3H,4H2,(H,11,12) |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 2765 |
| Flash Point: | 160 oC (0.4 torr) |
| Density: | 1.563 |
| Stability: | Stable, but moisture-sensitive and may be light-sensitive. Incompatible with strong oxidizing agents, corrodes many metals. Decomposes in water. |
| Refractive index: | 1.576 |
| Water Solubility: | Slightly soluble. Decomposes. 0.0890 g/100 mL |
| Solubility: | 160 oC (0.4 torr) |
| Appearance: | off-white to tan |
| Packinggroup: | III |
| HS Code: | 29189090 |
| Flash Point: | 160 oC (0.4 torr) |
| Color: | off-white to tan |
| Usage: | Herbicide. Used to increase latex output of old rubber trees |
| Safety Data | |
| Hazard Symbols |
Xn:Harmful
|
 |
|
