| Identification | |
| Name: | 2,6-Pyridinediamine,3-(2-phenyldiazenyl)- |
| Synonyms: | 2,6-Pyridinediamine,3-(phenylazo)- (9CI);Pyridine, 2,6-diamino-3-(phenylazo)- (6CI,7CI,8CI);2,6-Diamino-3-phenylazopyridine;Gastracid;Gastrotest;NSC 145895;Phenazopyridine;3-Phenylazopyridine-2,6-diamine; |
| CAS: | 94-78-0 |
| EINECS: | 202-363-2, 205-243-8 |
| Molecular Formula: | C11H11N5 |
| Molecular Weight: | 213.24 |
| InChI: | InChI=1/C11H11N5/c12-10-7-6-9(11(13)14-10)16-15-8-4-2-1-3-5-8/h1-7H,(H4,12,13,14)/b16-15+ |
| Molecular Structure: |  |
| Properties | |
| Transport: | 25kgs |
| Melting Point: | 235 - 240 C |
| Flash Point: | 442.3°Cat760mmHg |
| Boiling Point: | 442.3°Cat760mmHg |
| Density: | 1.32g/cm3 |
| Appearance: | dark red to violet crystalline powder |
| Report: |
IARC Cancer Review: Animal Inadequate Evidence IMEMDT IARC Monographs on the Evaluation of Carcinogenic Risk of Chemicals to Man . 8 ,1975,p. 117.(World Health Organization, Internation Agency for Research on Cancer,Lyon, France.: ) (Single copies can be ordered from WHO Publications Centre U.S.A., 49 Sheridan Avenue, Albany, NY 12210) . |
| Flash Point: | 442.3°Cat760mmHg |
| Color: | BROWNISH-YELLOW CRYSTALS |
| Safety Data | |
| Hazard Symbols | |
 |
|
