| Identification | ||
| Name: | 2,4-D butyl ester | |
| Synonyms: | Aceticacid, (2,4-dichlorophenoxy)-, butyl ester (6CI,8CI,9CI); 2,4-D Butylate; 2,4-Dbutyl ester; 2,4-DBE; 2,4-Dichlorophenoxyacetic acid butyl ester;2,4-Dichlorophenoxyacetic acid n-butyl ester; Butapon; Butyl(2,4-dichlorophenoxy)acetate; Butyl 2,4-D; Butyl dichlorophenoxyacetate; EssoHerbicide 10; Esteron 400BR; Fernesta; Hi-Ester 2,4-D; Lironox; NSC 409767 | |
| CAS: | 94-80-4 | |
| EINECS: | 202-364-8 | |
| Molecular Formula: | C12H14 Cl2 O3 | |
| Molecular Weight: | 277.144 | |
| InChI: | InChI=1S/C12H14Cl2O3/c1-2-3-6-16-12(15)8-17-11-5-4-9(13)7-10(11)14/h4-5,7H,2-3,6,8H2,1H3 | |
| Molecular Structure: |  |
|
| Properties | ||
| Transport: | UN 3082 | |
| Melting Point: | 9 | |
| Flash Point: | 146-147 oC | |
| Density: | 1.24 g/cm3 | |
| Stability: | Stable. Incompatible with strong oxidizing agents. | |
| Refractive index: | 1.519 | |
| Water Solubility: | <0.1 g/100 mL at 21 ºC | |
| Solubility: | Insoluble | |
| Appearance: | Light brown to brown liquid oil | |
| Specification: | colourless liquid Safety Statements:26-29-36/37-46-60-61 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 29:Do not empty into drains 36/37:Wear suitable protective clothing and gloves 46:If swallowed, seek medical advice immediately and show this container or label 60:This material and/or its container must be disposed of as hazardous waste 61:Avoid release to the environment. Refer to special instructions safety data sheet | |
| Packinggroup: | III | |
| Flash Point: | 146-147 oC | |
| Usage: | Herbicide for pasture & rangelands, agricultural use-eg, wheat, corn, grain sorghum, rice and other grains, industrialcommercial uses, lawns, turf, & aquatic use, other field crops-eg, nuts, component of herbicide for jungle defoliation-former use 2,4-d and derivatives. | |
| Safety Data | ||
| Hazard Symbols |
Xn:Harmful
|
|
 |
||
