| Identification | |
| Name: | 1'-Acetonaphthone |
| Synonyms: | 1'-Acetonaphthone(6CI,8CI);1-(1-Naphthalenyl)ethanone;1-(1-Naphthyl)ethanone;1-(Naphthalen-4-yl)ethanone;1-Acetonaphthalene;1-Acetonaphthone;1-Acetylnaphthalene;1-Naphthyl methyl ketone;Methyl 1-naphthyl ketone;Methyla-naphthyl ketone;NSC 7659;a-Acetonaphthone;a-Acetylnaphthalene;a-Naphthyl methyl ketone; |
| CAS: | 941-98-0 |
| EINECS: | 213-384-1 |
| Molecular Formula: | C12H10O |
| Molecular Weight: | 170.21 |
| InChI: | InChI=1/C12H10O/c1-9(13)11-8-4-6-10-5-2-3-7-12(10)11/h2-8H,1H3 |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.119 |
| Stability: | Stable under normal temperatures and pressures. |
| Refractive index: | 1.627-1.629 |
| Water Solubility: | immiscible |
| Solubility: | immiscible |
| Appearance: | Light yellow liquid. |
| Specification: |
?1'-Acetonaphthone , its CAS NO. is 941-98-0, the synonyms are 1-Acetylnaphthalene ; 1-Acetonaphthone ; alpha-Acetonaphthone ; alpha-Acetylnaphthalene ; 1-Acetonaphthalene ; 1-Naphthyl methyl ketone ; .alpha.-Acetonaphthone ; alpha-Naphthyl methyl ketone ; Methyl 1-naphthyl ketone ; 1-(1-naphthalenyl)-Ethanone ; 1-(1-naphthalenyl)-ethanon . |
| Report: |
Reported in EPA TSCA Inventory. |
| HS Code: | 29143900 |
| Storage Temperature: | Keep container closed when not in use. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Safety Data | |
| Hazard Symbols |
Xi:Irritant
|
 |
|
