| Identification | |
| Name: | Acetic acid,2-[(phenylthioxomethyl)thio]- |
| Synonyms: | Aceticacid, [(phenylthioxomethyl)thio]- (9CI); Benzoic acid, dithio-, carboxymethylester (6CI); Benzoic acid, dithio-, ester with mercaptoacetic acid (7CI,8CI);Acetic acid, mercapto-, dithiobenzoate (8CI); (Thiobenzoylthio)acetic acid;2-(Phenylcarbonothioylthio)acetic acid; Carboxymethyl dithiobenzoate; NSC42331; NSC 68200; Thiobenzoyl thioglycolate; [(Phenylcarbonothioyl)thio]aceticacid |
| CAS: | 942-91-6 |
| EINECS: | 213-393-0 |
| Molecular Formula: | C9H8 O2 S2 |
| Molecular Weight: | 212.29 |
| InChI: | InChI=1/C9H8O2S2/c10-8(11)6-13-9(12)7-4-2-1-3-5-7/h1-5H,6H2,(H,10,11) |
| Molecular Structure: | ![(C9H8O2S2) Aceticacid, [(phenylthioxomethyl)thio]- (9CI); Benzoic acid, dithio-, carboxymethylester (6CI); Benz...](https://img1.guidechem.com/chem/e/dict/38/942-91-6.jpg) |
| Properties | |
| Melting Point: | 125-127 oC |
| Density: | 1.379 g/cm3 |
| Stability: | Stable under normal temperatures and pressures. |
| Refractive index: | 1.673 |
| Solubility: | Very soluble |
| Appearance: | Dark red. |
| Specification: |
((Phenylthioxomethyl)thio)acetic acid , its CAS NO. is 942-91-6, the synonym is EINECS 213-393-0 . |
| HS Code: | 29309070 |
| Storage Temperature: | Store in a cool, dry place. Keep container closed when not in use. |
| Safety Data | |
| Hazard Symbols |
Xi: Irritant
|
 |
|
