| Identification | |
| Name: | 3-Methyl-N,N-diethylbenzamide |
| Synonyms: | 3-Methyl-N,N-diethylbenzamide |
| CAS: | 94271-03-1 |
| Molecular Formula: | C12H17NO |
| Molecular Weight: | 191.27 |
| InChI: | InChI=1S/C12H17NO/c1-4-13(5-2)12(14)11-8-6-7-10(3)9-11/h6-9H,4-5H2,1-3H3 |
| Molecular Structure: |  |
| Properties | |
| Boiling Point: | 160 deg C @ 19 mm Hg |
| Solubility: | Very soluble in benzene, ethyl ether, and ethanol. Sparingly sol in petroleum ether MISCIBLE WITH ETHANOL, 2-PROPANOL, COTTONSEED OIL, PROPYLENE GLYCOL Solubility in water = >1000 mg/l at room temperature |
| Color: | Liquid WATER WHITE TO AMBER |
| Safety Data | |
 |
|
