| Identification | |
| Name: | L-Phenylalanine,4-amino- |
| Synonyms: | Alanine,3-(p-aminophenyl)-, L- (8CI);4-Aminophenylalanine;Aminophenylalanine;L-(+)-p-Aminophenylalanine;L-4-Aminophenylalanine;p-Amino-L-phenylalanine;H-Phe(4-NH2)-OH; |
| CAS: | 943-80-6 |
| Molecular Formula: | C9H12N2O2 |
| Molecular Weight: | 180.20 |
| InChI: | InChI=1S/C9H12N2O2/c10-7-3-1-6(2-4-7)5-8(11)9(12)13/h1-4,8H,5,10-11H2,(H,12,13)/t8-/m0/s1 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 185.8°C |
| Boiling Point: | 383.5°Cat760mmHg |
| Density: | 1.289g/cm3 |
| Solubility: | slightly soluble in water |
| Appearance: | white needle crystal |
| Specification: | Safety Statements:26-36 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 36:Wear suitable protective clothing |
| Flash Point: | 185.8°C |
| Storage Temperature: | 2-8°C |
| Safety Data | |
| Hazard Symbols |
Xi: Irritant
|
 |
|
