| Identification |
| Name: | Benzenamine,5-chloro-2-methoxy- |
| Synonyms: | o-Anisidine,5-chloro- (7CI,8CI);(5-Chloro-2-methoxyphenyl)amine;1-Amino-5-chloro-2-methoxybenzene;2-Amino-4-chloro-1-methoxybenzene;2-Amino-4-chloroanisole;2-Methoxy-5-chloroaniline;4-Chloro-2-aminoanisole;5-Chloro-2-methoxyaniline;5-Chloro-o-anisidine;C.I. 37120, free base;NSC6114;Tulabase Fast Red R;Tulabase Fast Red RC; |
| CAS: | 95-03-4 |
| EINECS: | 202-385-2 |
| Molecular Formula: | C7H8ClNO |
| Molecular Weight: | 157.59962 |
| InChI: | InChI=1/C7H8ClNO/c1-10-7-3-2-5(8)4-6(7)9/h2-4H,9H2,1H3 |
| Molecular Structure: |
 |
| Properties |
| Transport: | UN 2233 6.1/PG 3 |
| Melting Point: | 81-83 °C(lit.)
|
| Flash Point: | 110.7°C |
| Boiling Point: | 135 °C (5.85078 mmHg)
|
| Density: | 1.234g/cm3 |
| Refractive index: | 1.572 |
| Solubility: | soluble in alcohol and ether and volatile with steam |
| Appearance: | Off-white to tan crystalline powder or flakes |
| Packinggroup: | III |
| Flash Point: | 110.7°C |
| Safety Data |
| Hazard Symbols |
Xn: Harmful
Xi: Irritant
|
| |
 |
