| Identification |
| Name: | 5-Norbornene-2-carbonitrile, mixture of endo and exo |
| Synonyms: | Bicyclo[2.2.1]-5-heptene-2-carbonitrile |
| CAS: | 95-11-4 |
| EINECS: | 202-391-5 |
| Molecular Formula: | C8H9N |
| Molecular Weight: | 119.16 |
| InChI: | InChI=1/C8H9N/c9-5-8-4-6-1-2-7(8)3-6/h1-2,6-8H,3-4H2 |
| Molecular Structure: |
![(C8H9N) Bicyclo[2.2.1]-5-heptene-2-carbonitrile](https://img.guidechem.com/casimg/95-11-4.gif) |
| Properties |
| Density: | 0.999 |
| Stability: | Stable under normal temperatures and pressures. |
| Refractive index: | 1.4875-1.4895 |
| Solubility: | Slightly soluble |
| Appearance: | clear, colorless clear liquid |
| Storage Temperature: | Keep away from heat, sparks, and flame. Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Safety Data |
| Hazard Symbols |
Xn:Harmful
|
| |
 |
