| Identification | |
| Name: | Benzothiazole |
| Synonyms: | Benzothiazole,96% |
| CAS: | 95-16-9 |
| EINECS: | 202-396-2 |
| Molecular Formula: | C7H5NS |
| Molecular Weight: | 135.19 |
| InChI: | InChI=1/C7H5NS/c1-2-4-7-6(3-1)8-5-9-7/h1-5H |
| Molecular Structure: |  |
| Properties | |
| Transport: | 2810 |
| Flash Point: | 96.6°C |
| Density: | 1.238 |
| Stability: | Stable - regarded as highly persistent in the environment. Incompatible with strong oxidizing agents. Combustion products: nitrogen oxides, carbon monoxide, carbon dioxide, sulphur oxides. |
| Refractive index: | 1.641-1.644 |
| Water Solubility: | slightly soluble |
| Solubility: | slightly soluble |
| Appearance: | yellow liquid with an unpleasant odour |
| Packinggroup: | III |
| HS Code: | 29342080 |
| Flash Point: | 96.6°C |
| Storage Temperature: | Keep away from heat and flame. Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. Keep away from water. |
| Color: | Yellow liquid |
| Usage: | Various benzothiazole-benzamides synthesized were evaluated for their analgesic and antidepressant activities. |
| Safety Data | |
| Hazard Symbols |
Xn:Harmful
|
 |
|
