| Identification | |
| Name: | o-Cresol |
| Synonyms: | 2-Hydroxytoluene; 2-Methylphenol; 2-Cresol |
| CAS: | 95-48-7 |
| EINECS: | 202-423-8 |
| Molecular Formula: | C7H8O |
| Molecular Weight: | 108.14 |
| InChI: | InChI=1/C7H8O/c1-6-4-2-3-5-7(6)8/h2-5,8H,1H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 2076/3455 |
| Density: | 1.04 |
| Stability: | Stable, but light and air sensitive. Combustible. Incompatible with oxidizing agents, bases. |
| Refractive index: | 1.5361 |
| Solubility: | 23 g/l SOLVENT |
| Appearance: | Clear to to slightly amber liquid |
| Packinggroup: | II |
| HS Code: | 29071200 |
| Color: | white to brown |
| Usage: | For making synthetic resins, in disinfectants and fumigants, as industrial solvent. |
| Safety Data | |
| Hazard Symbols |
T:Toxic
|
 |
|
