| Identification | ||
| Name: | 3,4-Dichlorophenol | |
| Synonyms: | - | |
| CAS: | 95-77-2 | |
| EINECS: | 202-450-5 | |
| Molecular Formula: | C6H4Cl2O | |
| Molecular Weight: | 163 | |
| InChI: | InChI=1/C6H4Cl2O/c7-5-2-1-4(9)3-6(5)8/h1-3,9H | |
| Molecular Structure: |  |
|
| Properties | ||
| Transport: | UN 2020 | |
| Density: | 1.458 g/cm3 | |
| Stability: | Stable. Combustible. Incompatible with oxidizing agents, acid chlorides, acid anhydrides. | |
| Refractive index: | 1.593 | |
| Water Solubility: | <0.1 g/100 mL at 20 ºC | |
| Solubility: | <0.1 g/100 mL at 20 oC in water | |
| Appearance: | light yellow to brown crystals | |
| Specification: | light yellow to brown crystals Safety Statements:26-28-37/39 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 28:After contact with skin, wash immediately with plenty of ... (to be specified by the manufacturer) 37/39:Wear suitable protective clothing, gloves and eye/face protection | |
| Packinggroup: | III | |
| HS Code: | 29081000 | |
| Color: | Needles from benzene-petroleum ether | |
| Usage: | Chemical intermediate for 2-chloro-1,4-dihydroxyanthraquinone & 2,3,4-trichlorophenol. | |
| Safety Data | ||
| Hazard Symbols |
Xn:Harmful
|
|
 |
||
