| Identification | |
| Name: | 2-Propenoic acid,3-(4-nitrophenyl)-, ethyl ester |
| Synonyms: | Cinnamicacid, p-nitro-, ethyl ester (6CI,7CI,8CI);3-(4-Nitrophenyl)-2-propenoic acidethyl ester;3-(4-Nitrophenyl)acrylic acid ethyl ester;Ethyl p-nitrocinnamate;NSC 4697;NSC 636709; |
| CAS: | 953-26-4 |
| EINECS: | 213-463-0 |
| Molecular Formula: | C11H11NO4 |
| Molecular Weight: | 221.21 |
| InChI: | InChI=1/C11H11NO4/c1-2-16-11(13)8-5-9-3-6-10(7-4-9)12(14)15/h3-8H,2H2,1H3/b8-5+ |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 141°C |
| Boiling Point: | 326.6°Cat760mmHg |
| Density: | 1.237g/cm3 |
| Stability: | Stable under normal temperatures and pressures. |
| Refractive index: | 1.582 |
| Water Solubility: | insoluble |
| Solubility: | insoluble |
| Appearance: | Yellow powder. |
| Specification: |
2-Propenoic acid, 3-(4-nitrophenyl)-, ethyl ester , its cas register number is 953-26-4. It also can be called 1-09-00-00247 (Beilstein Handbook Reference) ; AI3-19857 ; BRN 2052533 ; Cinnamic acid, p-nitro-, ethyl ester ; Ethyl 4-nitrocinnamate ; Ethyl p-nitrocinnamate ; NSC 4697 ; Propenoic acid, 3-(4-nitrophenyl)-, ethyl ester . It is a light yellow-beige to yellow fine cryst. powder. |
| HS Code: | 29163900 |
| Flash Point: | 141°C |
| Storage Temperature: | Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Safety Data | |
 |
|
