| Identification | |
| Name: | Dibasic ester |
| CAS: | 95481-62-2 |
| Molecular Formula: | C8H14O4.C7H12O4.C6H10O4 |
| Molecular Weight: | 480.5 |
| InChI: | InChI=1/C8H14O4.C7H12O4.C6H10O4/c1-11-7(9)5-3-4-6-8(10)12-2;1-10-6(8)4-3-5-7(9)11-2;1-9-5(7)3-4-6(8)10-2/h3-6H2,1-2H3;3-5H2,1-2H3;3-4H2,1-2H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 3265 8 |
| Refractive index: | n20/D 1.424(lit.) |
| Appearance: | liquid |
| Specification: |
In chemistry,?Dibasic ester(CAS NO.95481-62-2) is an ester of a dicarboxylic acid. Mixtures of different methyl dibasic esters are commercially produced from short-chain acids such as adipic acid, glutaric acid, and succinic acid. They are non-flammable, readily biodegradable, non-corrosive, and have a mild, fruity odour. Dibasic esters of phthalates, adipates, and azelates with C8 - C10 alcohols?are used as lubricants, spin finishes, and additives. |
| Safety Data | |
 |
|
