| Identification | |
| Name: | Diphenamid |
| Synonyms: | Acetamide,N,N-dimethyl-2,2-diphenyl- (8CI); Diphenamide (6CI,7CI); Dif 4; Diherbid;Dimid; Diphenamid; Diphenylacetic acid dimethylamide; Dymid; Enide; Enide 50;Enide 50W; Fenam; L 34314; Lilly 34,314; N,N-Dimethyl-2,2-diphenylacetamide;N,N-Dimethyl-a,a-diphenylacetamide;N,N-Dimethyldiphenylacetamide; Rideon; Zarur |
| CAS: | 957-51-7 |
| EINECS: | 213-482-4 |
| Molecular Formula: | C16H17 N O |
| Molecular Weight: | 239.3123 |
| InChI: | InChI=1S/C16H17NO/c1-17(2)16(18)15(13-9-5-3-6-10-13)14-11-7-4-8-12-14/h3-12,15H,1-2H3 |
| Molecular Structure: |  |
| Properties | |
| Melting Point: | 132-136 ºC |
| Flash Point: | 173.3 ºC |
| Boiling Point: | 382.4 ºC |
| Density: | 1.07 g/cm3 |
| Stability: | Stable. Incompatible with strong oxidizing agents, strong bases. |
| Water Solubility: | -2.98 in water |
| Solubility: | -2.98 in water |
| Appearance: | white or off-white powder |
| Specification: |
N,N-Dimethyl-2,2-Diphenylacetamide (CAS NO.957-51-7) is a colorless to off-white crystals. It is an amide. Amides/imides react with azo and diazo compounds to generate toxic gases. Flammable gases are formed by the reaction of organic amides/imides with strong reducing agents. Amides are very weak bases (weaker than water). Imides are less basic yet and in fact react with strong bases to form salts. That is, they can react as acids. Mixing amides with dehydrating agents such as P2O5 or SOCl2 generates the corresponding nitrile. The combustion of these compounds generates mixed oxides of nitrogen (NOx). Also it is decomposed by strong base or acid. |
| Flash Point: | 173.3 ºC |
| Storage Temperature: | 0-6°C |
| Color: | WHITE CRYSTALS FROM ETHYL ACETATE WHITE PRISMS Colorless |
| Safety Data | |
| Hazard Symbols |
Xn: Harmful
|
 |
|
