| Identification | |
| Name: | Benzaldehyde,2-hydroxy-, 2-[(2-hydroxyphenyl)methylene]hydrazone |
| Synonyms: | Benzaldehyde,2-hydroxy-, [(2-hydroxyphenyl)methylene]hydrazone (9CI);Salicylaldehyde, azine(6CI,7CI,8CI);2,2'-Dihydroxybenzalazine;Bis[2-hydroxybenzaldehyde] hydrazone;N,N'-Bis(salicylidene)hydrazine;NSC 695048;NSC 864;Salazine;Salicylalazine;o-Hydroxybenzaldazine;6-[[2-[(6-oxocyclohexa-2,4-dien-1-ylidene)methyl]hydrazinyl]methylidene]cyclohexa-2,4-dien-1-one; |
| CAS: | 959-36-4 |
| EINECS: | 213-500-0 |
| Molecular Formula: | C14H12N2O2 |
| Molecular Weight: | 240.26 |
| InChI: | InChI=1/C14H12N2O2/c17-13-7-3-1-5-11(13)9-15-16-10-12-6-2-4-8-14(12)18/h1-10,17-18H/b15-9+,16-10+ |
| Molecular Structure: | ![(C14H12N2O2) Benzaldehyde,2-hydroxy-, [(2-hydroxyphenyl)methylene]hydrazone (9CI);Salicylaldehyde, azine(6CI,7CI,...](https://img.guidechem.com/casimg/959-36-4.gif) |
| Properties | |
| Density: | 1.17 g/cm3 |
| Refractive index: | 1.596 |
| Water Solubility: | insoluble in water |
| Solubility: | insoluble in water |
| Appearance: | yellow powder. |
| Specification: | Yellow Solid usageEng:Hydrazone derivative with anthelminthic activity. Safety Statements:26-36/37/39 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 36/37/39:Wear suitable protective clothing, gloves and eye/face protection |
| Storage Temperature: | Refrigerator |
| Usage: | Hydrazone derivative with anthelminthic activity. |
| Safety Data | |
 |
|
